EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O6 |
| Net Charge | 0 |
| Average Mass | 422.477 |
| Monoisotopic Mass | 422.17294 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc2oc(-c3ccc(O)cc3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C25H26O6/c1-14(2)5-4-6-15(3)7-12-18-19(27)13-20-21(22(18)28)23(29)24(30)25(31-20)16-8-10-17(26)11-9-16/h5,7-11,13,26-28,30H,4,6,12H2,1-3H3/b15-7+ |
| InChIKey | MBIJQAHZUBUPNM-VIZOYTHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga bicolor (ncbitaxon:396452) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macarangin (CHEBI:70022) has role plant metabolite (CHEBI:76924) |
| macarangin (CHEBI:70022) is a 7-hydroxyflavonol (CHEBI:52267) |
| macarangin (CHEBI:70022) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 6-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3634678 | Reaxys |
| Citations |
|---|