EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(O)cc(O)c(CC=C(C)C)c3O2)cc1 |
| InChI | InChI=1S/C21H22O5/c1-12(2)4-9-15-16(22)10-17(23)20-18(24)11-19(26-21(15)20)13-5-7-14(25-3)8-6-13/h4-8,10,19,22-23H,9,11H2,1-3H3/t19-/m0/s1 |
| InChIKey | CTFJUDTWKJHYNX-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga bicolor (ncbitaxon:396452) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chroman-4-one (CHEBI:70021) has functional parent (2S)-flavanone (CHEBI:15606) |
| (S)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chroman-4-one (CHEBI:70021) has role plant metabolite (CHEBI:76924) |
| (S)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chroman-4-one (CHEBI:70021) is a 4'-methoxyflavanones (CHEBI:140332) |
| (S)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chroman-4-one (CHEBI:70021) is a dihydroxyflavanone (CHEBI:38749) |
| (S)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chroman-4-one (CHEBI:70021) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 4'-O-methyl-8-prenylnaringenin | ChEBI |
| (2S)-5,7-dihydroxy-4'-methoxy-8-prenylflavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9353342 | Reaxys |
| Citations |
|---|