EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O6 |
| Net Charge | 0 |
| Average Mass | 424.493 |
| Monoisotopic Mass | 424.18859 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc(O)c2c1O[C@H](c1cc(O)cc(O)c1)CC2=O |
| InChI | InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-8-19-20(28)12-21(29)24-22(30)13-23(31-25(19)24)16-9-17(26)11-18(27)10-16/h5,7,9-12,23,26-29H,4,6,8,13H2,1-3H3/b15-7+/t23-/m0/s1 |
| InChIKey | CUAHQWHCZQIDAM-KETROQBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga bicolor (ncbitaxon:396452) | - | PubMed (21275386) | Methanol-Dichloromethane (1:1) extract of dried, ground plant material |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. breast cancer resistance protein inhibitor Any inhibitor of breast cancer resistance protein (ABCG2). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5,7,3',5'-tetrahydroxy-8-[3'',8''-dimethylocta-2''(E),7''-dienyl]flavonone (CHEBI:70020) has functional parent (2S)-flavanone (CHEBI:15606) |
| (2S)-5,7,3',5'-tetrahydroxy-8-[3'',8''-dimethylocta-2''(E),7''-dienyl]flavonone (CHEBI:70020) has role breast cancer resistance protein inhibitor (CHEBI:72771) |
| (2S)-5,7,3',5'-tetrahydroxy-8-[3'',8''-dimethylocta-2''(E),7''-dienyl]flavonone (CHEBI:70020) has role metabolite (CHEBI:25212) |
| (2S)-5,7,3',5'-tetrahydroxy-8-[3'',8''-dimethylocta-2''(E),7''-dienyl]flavonone (CHEBI:70020) is a 3'-hydroxyflavanones (CHEBI:48024) |
| (2S)-5,7,3',5'-tetrahydroxy-8-[3'',8''-dimethylocta-2''(E),7''-dienyl]flavonone (CHEBI:70020) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-(3,5-dihydroxyphenyl)-8-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312877 | Reaxys |
| Citations |
|---|