EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO4 |
| Net Charge | 0 |
| Average Mass | 301.342 |
| Monoisotopic Mass | 301.13141 |
| SMILES | [H][C@@]12C=C[C@H](O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CC[N+](C)([O-])[C@@H]2C5 |
| InChI | InChI=1S/C17H19NO4/c1-18(21)7-6-17-10-3-5-13(20)16(17)22-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-,18?/m0/s1 |
| InChIKey | AMAPEXTUMXQULJ-APQDOHRLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Morphine N-oxide (CHEBI:7002) is a morphinane alkaloid (CHEBI:25418) |
| Morphine N-oxide (CHEBI:7002) is a tertiary amine oxide (CHEBI:134363) |
| Synonym | Source |
|---|---|
| Morphine N-oxide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11786 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:639-46-3 | KEGG COMPOUND |