EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc(O)c1OC |
| InChI | InChI=1S/C18H16O8/c1-23-13-5-8(4-11(21)17(13)24-2)16-18(25-3)15(22)14-10(20)6-9(19)7-12(14)26-16/h4-7,19-21H,1-3H3 |
| InChIKey | YTYFGDJADQYGLC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5,7-trihydroxy-3,4',5'-trimethoxyflavone (CHEBI:70009) has functional parent myricetin (CHEBI:18152) |
| 3',5,7-trihydroxy-3,4',5'-trimethoxyflavone (CHEBI:70009) has role plant metabolite (CHEBI:76924) |
| 3',5,7-trihydroxy-3,4',5'-trimethoxyflavone (CHEBI:70009) is a dihydroxyflavone (CHEBI:38686) |
| 3',5,7-trihydroxy-3,4',5'-trimethoxyflavone (CHEBI:70009) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-3-methoxy-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| myricetin 3,3',4'-trimethylether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12112791 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8939041 | Reaxys |
| Citations |
|---|