EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-11(19)13(6-9)23-2/h4-8,19-20H,1-3H3 |
| InChIKey | KQFUXLQBMQGNRT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Euodia elleryana (IPNI:772987-1) | - | PubMed (21275386) | MeOH-CH2Cl2(1:1)extract of dried, ground plant material,synonym Euodia is captured instead of Evodia |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pachypodol (CHEBI:70007) has functional parent quercetin (CHEBI:16243) |
| pachypodol (CHEBI:70007) has role antiemetic (CHEBI:50919) |
| pachypodol (CHEBI:70007) has role plant metabolite (CHEBI:76924) |
| pachypodol (CHEBI:70007) is a dihydroxyflavone (CHEBI:38686) |
| pachypodol (CHEBI:70007) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Quercetin 3,7,3'-trimethyl ether | KEGG COMPOUND |
| 5,4'-dihydroxy-3,7,3'-trimethoxyflavone | ChEBI |
| 5,4'-dihydroxy-3,7,3'-quercetol trimethyl ether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10117 | KEGG COMPOUND |
| LMPK12112754 | LIPID MAPS |
| Pachypodol | Wikipedia |
| C00004646 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:344651 | Reaxys |
| CAS:33708-72-4 | KEGG COMPOUND |
| CAS:33708-72-4 | ChemIDplus |
| Citations |
|---|