EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3cc(O)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C19H18O8/c1-23-10-7-11(20)15-13(8-10)27-17(19(26-4)16(15)22)9-5-12(21)18(25-3)14(6-9)24-2/h5-8,20-21H,1-4H3 |
| InChIKey | LLDTYMGZAXZDDU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5-dihydroxy-3,4',5',7-tetramethoxyflavone (CHEBI:70006) has functional parent myricetin (CHEBI:18152) |
| 3',5-dihydroxy-3,4',5',7-tetramethoxyflavone (CHEBI:70006) has role metabolite (CHEBI:25212) |
| 3',5-dihydroxy-3,4',5',7-tetramethoxyflavone (CHEBI:70006) has role plant metabolite (CHEBI:76924) |
| 3',5-dihydroxy-3,4',5',7-tetramethoxyflavone (CHEBI:70006) is a dihydroxyflavone (CHEBI:38686) |
| 3',5-dihydroxy-3,4',5',7-tetramethoxyflavone (CHEBI:70006) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| myricetin 3,7,3',4'-tetramethyl ether | ChEBI |
| 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMPK12112792 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1406939 | Reaxys |
| CAS:14290-57-4 | ChemIDplus |
| Citations |
|---|