EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O8 |
| Net Charge | 0 |
| Average Mass | 388.372 |
| Monoisotopic Mass | 388.11582 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C20H20O8/c1-23-11-8-12(21)16-13(9-11)28-18(20(27-5)17(16)22)10-6-14(24-2)19(26-4)15(7-10)25-3/h6-9,21H,1-5H3 |
| InChIKey | SUNUQCQIFHHEOW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretol (CHEBI:70005) has functional parent myricetin (CHEBI:18152) |
| combretol (CHEBI:70005) has role antileishmanial agent (CHEBI:70868) |
| combretol (CHEBI:70005) has role metabolite (CHEBI:25212) |
| combretol (CHEBI:70005) has role plant metabolite (CHEBI:76924) |
| combretol (CHEBI:70005) is a monohydroxyflavone (CHEBI:38687) |
| combretol (CHEBI:70005) is a pentamethoxyflavone (CHEBI:38724) |
| IUPAC Name |
|---|
| 5-hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5-hydroxy-3,3',4',5',7-pentamethoxyflavone | ChEBI |
| myricetin-3,7,3',4',5'-pentamethylether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Combretol | Wikipedia |
| LMPK12112794 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:357241 | Reaxys |
| Citations |
|---|