EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O8 |
| Net Charge | 0 |
| Average Mass | 346.291 |
| Monoisotopic Mass | 346.06887 |
| SMILES | COc1c(O)cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc1O |
| InChI | InChI=1S/C17H14O8/c1-23-16-10(20)3-7(4-11(16)21)15-17(24-2)14(22)13-9(19)5-8(18)6-12(13)25-15/h3-6,18-21H,1-2H3 |
| InChIKey | MVJHAGLBHWPKLS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7,3',5'-tetrahydroxy-3,4'-dimethyoxyflavone (CHEBI:70004) has functional parent myricetin (CHEBI:18152) |
| 5,7,3',5'-tetrahydroxy-3,4'-dimethyoxyflavone (CHEBI:70004) has role plant metabolite (CHEBI:76924) |
| 5,7,3',5'-tetrahydroxy-3,4'-dimethyoxyflavone (CHEBI:70004) is a dimethoxyflavone (CHEBI:23798) |
| 5,7,3',5'-tetrahydroxy-3,4'-dimethyoxyflavone (CHEBI:70004) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-3-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,4'-O-dimethylmyricetin | ChEBI |
| myricetin 3,4'-dimethyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6745154 | Reaxys |
| Citations |
|---|