EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O6 |
| Net Charge | 0 |
| Average Mass | 530.746 |
| Monoisotopic Mass | 530.36074 |
| SMILES | [H][C@@]12C[C@H](OC(C)=O)[C@@]3([H])[C@]4(C)CC[C@]([H])([C@H](C)CC[C@H](O)C(=C)C)[C@@]4(C)CC[C@]34C[C@]14CC[C@H](O)[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C32H50O6/c1-18(2)22(34)9-8-19(3)21-10-12-29(6)26-23(38-20(4)33)16-24-30(7,27(36)37)25(35)11-13-31(24)17-32(26,31)15-14-28(21,29)5/h19,21-26,34-35H,1,8-17H2,2-7H3,(H,36,37)/t19-,21-,22+,23+,24+,25+,26+,28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | PYMOVAUYBLDWHR-OFMKDZFSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretic acid B (CHEBI:70003) has parent hydride cycloartane (CHEBI:37778) |
| combretic acid B (CHEBI:70003) has role metabolite (CHEBI:25212) |
| combretic acid B (CHEBI:70003) has role plant metabolite (CHEBI:76924) |
| combretic acid B (CHEBI:70003) is a acetate ester (CHEBI:47622) |
| combretic acid B (CHEBI:70003) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| combretic acid B (CHEBI:70003) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| rel-(24S)-7β-(acetyloxy)-3,24-dihydroxy-9β,19-cyclolanost-25-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312863 | Reaxys |
| Citations |
|---|