EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O6 |
| Net Charge | 0 |
| Average Mass | 532.762 |
| Monoisotopic Mass | 532.37639 |
| SMILES | [H][C@@]12C[C@H](OC(C)=O)[C@@]3([H])[C@]4(C)CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]4(C)CC[C@]34C[C@]14CC[C@H](O)[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C32H52O6/c1-19(9-8-12-27(3,4)37)21-10-13-29(6)25-22(38-20(2)33)17-23-30(7,26(35)36)24(34)11-14-31(23)18-32(25,31)16-15-28(21,29)5/h19,21-25,34,37H,8-18H2,1-7H3,(H,35,36)/t19-,21-,22+,23+,24+,25+,28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | LOKNWCZJYFDEAJ-CGWCZXMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretic acid A (CHEBI:70002) has parent hydride cycloartane (CHEBI:37778) |
| combretic acid A (CHEBI:70002) has role plant metabolite (CHEBI:76924) |
| combretic acid A (CHEBI:70002) is a acetate ester (CHEBI:47622) |
| combretic acid A (CHEBI:70002) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| combretic acid A (CHEBI:70002) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (4R*,7R*)-7-acetyloxy-3β,25-dihydroxy-9β,19-cyclolanostan-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312861 | Reaxys |
| Citations |
|---|