EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O3 |
| Net Charge | 0 |
| Average Mass | 470.738 |
| Monoisotopic Mass | 470.37600 |
| SMILES | [H][C@@]12[C@@H](O)C[C@@]3([H])C(C)(C)C(=O)CC[C@@]34C[C@]41CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)C/C=C/C(C)(C)OC |
| InChI | InChI=1S/C31H50O3/c1-20(10-9-13-26(2,3)34-8)21-11-14-29(7)25-22(32)18-23-27(4,5)24(33)12-15-30(23)19-31(25,30)17-16-28(21,29)6/h9,13,20-23,25,32H,10-12,14-19H2,1-8H3/b13-9+/t20-,21-,22+,23+,25+,28-,29+,30-,31+/m1/s1 |
| InChIKey | PSQJXRKLAZZNHC-OLKLHFONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretanone G (CHEBI:70001) has parent hydride cycloartane (CHEBI:37778) |
| combretanone G (CHEBI:70001) has role metabolite (CHEBI:25212) |
| combretanone G (CHEBI:70001) has role plant metabolite (CHEBI:76924) |
| combretanone G (CHEBI:70001) is a 3-oxo-5α-steroid (CHEBI:13601) |
| combretanone G (CHEBI:70001) is a cyclic terpene ketone (CHEBI:36130) |
| combretanone G (CHEBI:70001) is a ether (CHEBI:25698) |
| combretanone G (CHEBI:70001) is a pentacyclic triterpenoid (CHEBI:25872) |
| combretanone G (CHEBI:70001) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (23E)-7β-hydroxy-25-methoxy-9β,19-cyclolanost-23-en-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312857 | Reaxys |
| Citations |
|---|