EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O3 |
| Net Charge | 0 |
| Average Mass | 470.738 |
| Monoisotopic Mass | 470.37600 |
| SMILES | [H][C@@]12[C@@H](O)C[C@@]3([H])C(C)(C)C(=O)CC[C@@]34C[C@]41CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC(C)(O)C(=C)C |
| InChI | InChI=1S/C31H50O3/c1-19(2)29(8,34)13-9-20(3)21-10-12-28(7)25-22(32)17-23-26(4,5)24(33)11-14-30(23)18-31(25,30)16-15-27(21,28)6/h20-23,25,32,34H,1,9-18H2,2-8H3/t20-,21-,22+,23+,25+,27-,28+,29?,30-,31+/m1/s1 |
| InChIKey | DYFQGNVJYMAFHT-XPZPHRGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretanone E (CHEBI:69999) has parent hydride cycloartane (CHEBI:37778) |
| combretanone E (CHEBI:69999) has role metabolite (CHEBI:25212) |
| combretanone E (CHEBI:69999) has role plant metabolite (CHEBI:76924) |
| combretanone E (CHEBI:69999) is a 3-oxo-5α-steroid (CHEBI:13601) |
| combretanone E (CHEBI:69999) is a cyclic terpene ketone (CHEBI:36130) |
| combretanone E (CHEBI:69999) is a diol (CHEBI:23824) |
| combretanone E (CHEBI:69999) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 7β,24-dihydroxy-24-methyl-9β,19-cyclolanost-25-en-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312860 | Reaxys |
| Citations |
|---|