EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@@]12[C@@H](O)C[C@@]3([H])C(C)(C)C(=O)CC[C@@]34C[C@]41CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)C/C=C/C(C)(C)O |
| InChI | InChI=1S/C30H48O3/c1-19(9-8-12-25(2,3)33)20-10-13-28(7)24-21(31)17-22-26(4,5)23(32)11-14-29(22)18-30(24,29)16-15-27(20,28)6/h8,12,19-22,24,31,33H,9-11,13-18H2,1-7H3/b12-8+/t19-,20-,21+,22+,24+,27-,28+,29-,30+/m1/s1 |
| InChIKey | RROWKYAPFZNHKO-FVOKRUCCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretanone C (CHEBI:69997) has parent hydride cycloartane (CHEBI:37778) |
| combretanone C (CHEBI:69997) has role plant metabolite (CHEBI:76924) |
| combretanone C (CHEBI:69997) is a 3-oxo-5α-steroid (CHEBI:13601) |
| combretanone C (CHEBI:69997) is a cyclic terpene ketone (CHEBI:36130) |
| combretanone C (CHEBI:69997) is a diol (CHEBI:23824) |
| combretanone C (CHEBI:69997) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (23E)-7β,25-dihydroxy-9β,19-cyclolanost-23-en-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312856 | Reaxys |
| Citations |
|---|