EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O6 |
| Net Charge | 0 |
| Average Mass | 506.724 |
| Monoisotopic Mass | 506.36074 |
| SMILES | [H][C@@]12C[C@H](O)[C@@]3([H])[C@]4(C)CC[C@]([H])([C@H](C)C[C@@H](O)[C@H](O)C(C)(C)O)[C@@]4(C)CC[C@]34C[C@]14CCC(=O)[C@@]2(C)CO |
| InChI | InChI=1S/C30H50O6/c1-17(13-20(33)24(35)25(2,3)36)18-7-9-28(6)23-19(32)14-21-26(4,16-31)22(34)8-10-29(21)15-30(23,29)12-11-27(18,28)5/h17-21,23-24,31-33,35-36H,7-16H2,1-6H3/t17-,18-,19+,20-,21+,23+,24+,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | KIGVCZYFPXRACV-WRPPEDOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Combretum quadrangulare (IPNI:170410-1) | leaf (BTO:0000713) | PubMed (21265555) | Methanolic extract of leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| combretanone B (CHEBI:69996) has parent hydride cycloartane (CHEBI:37778) |
| combretanone B (CHEBI:69996) has role plant metabolite (CHEBI:76924) |
| combretanone B (CHEBI:69996) is a 3-oxo-5α-steroid (CHEBI:13601) |
| combretanone B (CHEBI:69996) is a 4α-hydroxymethyl steroid (CHEBI:145944) |
| combretanone B (CHEBI:69996) is a cyclic terpene ketone (CHEBI:36130) |
| combretanone B (CHEBI:69996) is a pentacyclic triterpenoid (CHEBI:25872) |
| combretanone B (CHEBI:69996) is a pentol (CHEBI:37205) |
| IUPAC Name |
|---|
| (23R*,24S*)-7β,23,24,25,28-pentahydroxy-9β,19-cyclolanostan-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21312864 | Reaxys |
| Citations |
|---|