EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O7 |
| Net Charge | 0 |
| Average Mass | 430.497 |
| Monoisotopic Mass | 430.19915 |
| SMILES | CC[C@H](OC(C)=O)c1cc(=O)oc2c(C(=O)[C@@H](C)CC)c(O)c(CC=C(C)C)c(O)c12 |
| InChI | InChI=1S/C24H30O7/c1-7-13(5)21(27)20-23(29)15(10-9-12(3)4)22(28)19-16(11-18(26)31-24(19)20)17(8-2)30-14(6)25/h9,11,13,17,28-29H,7-8,10H2,1-6H3/t13-,17-/m0/s1 |
| InChIKey | CIJFRPODNXMJFU-GUYCJALGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mammea americana (ncbitaxon:198777) | |||
| stem (BTO:0001300) | PubMed (21214226) | Previous component: stem bark; Dichloromethane/Methanol (1:1) extract of dried stem bark | |
| stem (BTO:0001300) | PubMed (20929261) | Previous component: stem bark; Dried plant material(stem bark) was extracted with CH2Cl2-MeOH(1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mammea E/BB (CHEBI:69994) has role metabolite (CHEBI:25212) |
| Mammea E/BB (CHEBI:69994) is a hydroxycoumarin (CHEBI:37912) |
| Synonym | Source |
|---|---|
| 1-[5,7-Dihydroxy-8-(2-methylbutanoyl)-6-(3-methyl-2-buten-1-yl)-2-oxo-2H-chromen-4-yl]propyl acetate | ChEBI |
| Citations |
|---|