EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26O5 |
| Net Charge | 0 |
| Average Mass | 406.478 |
| Monoisotopic Mass | 406.17802 |
| SMILES | CC(C)=CCc1c(O)c(C(=O)CC(C)C)c2oc(=O)cc(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C25H26O5/c1-14(2)10-11-17-23(28)21-18(16-8-6-5-7-9-16)13-20(27)30-25(21)22(24(17)29)19(26)12-15(3)4/h5-10,13,15,28-29H,11-12H2,1-4H3 |
| InChIKey | SBHOAZQBEGVQLJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mammea americana (ncbitaxon:198777) | stem (BTO:0001300) | PubMed (21214226) | Previous component: stem bark; Dichloromethane/Methanol (1:1) extract of dried stem bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mammea A/BA (CHEBI:69992) has role metabolite (CHEBI:25212) |
| Mammea A/BA (CHEBI:69992) is a neoflavonoid (CHEBI:71971) |
| Synonyms | Source |
|---|---|
| 5,7-Dihydroxy-8-(3-methylbutanoyl)-6-(3-methyl-2-buten-1-yl)-4-phenyl-2H-chromen-2-one | ChEBI |
| isomammeisin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030779 | HMDB |
| LSM-4064 | LINCS |
| Citations |
|---|