EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O5 |
| Net Charge | 0 |
| Average Mass | 400.515 |
| Monoisotopic Mass | 400.22497 |
| SMILES | CCCCCc1cc(=O)oc2c(C(=O)CC(C)C)c(O)c(CC=C(C)C)c(O)c12 |
| InChI | InChI=1S/C24H32O5/c1-6-7-8-9-16-13-19(26)29-24-20(16)22(27)17(11-10-14(2)3)23(28)21(24)18(25)12-15(4)5/h10,13,15,27-28H,6-9,11-12H2,1-5H3 |
| InChIKey | WPWGYCSQNLHWAN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mammea americana (ncbitaxon:198777) | stem (BTO:0001300) | PubMed (21214226) | Previous component: stem bark; Dichloromethane/Methanol (1:1) extract of dried stem bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7-dihydroxy-6-(3-methylbut-2-enyl)-8-(3-methylbutanoyl)-4-pentyl-2H-chromen-2-one (CHEBI:69984) has role metabolite (CHEBI:25212) |
| 5,7-dihydroxy-6-(3-methylbut-2-enyl)-8-(3-methylbutanoyl)-4-pentyl-2H-chromen-2-one (CHEBI:69984) is a hydroxycoumarin (CHEBI:37912) |
| Citations |
|---|