EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O5 |
| Net Charge | 0 |
| Average Mass | 316.353 |
| Monoisotopic Mass | 316.13107 |
| SMILES | COc1cc([C@@H]2C[C@H](c3ccc(O)cc3)OC[C@H]2O)ccc1O |
| InChI | InChI=1S/C18H20O5/c1-22-18-8-12(4-7-15(18)20)14-9-17(23-10-16(14)21)11-2-5-13(19)6-3-11/h2-8,14,16-17,19-21H,9-10H2,1H3/t14-,16+,17+/m0/s1 |
| InChIKey | OSCHVWVCQJBFNN-USXIJHARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sequosempervirin F (CHEBI:69977) has role metabolite (CHEBI:25212) |
| Sequosempervirin F (CHEBI:69977) is a phenylpropanoid (CHEBI:26004) |
| Citations |
|---|