EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | [H][C@@]12CCC(=C)[C@H](/C=C/C(C)=O)[C@@]1(C)CCC[C@]2(C)C(=O)O |
| InChI | InChI=1S/C18H26O3/c1-12-6-9-15-17(3,14(12)8-7-13(2)19)10-5-11-18(15,4)16(20)21/h7-8,14-15H,1,5-6,9-11H2,2-4H3,(H,20,21)/b8-7+/t14-,15+,17+,18-/m0/s1 |
| InChIKey | BQLIBSZGTNAGNT-OQOGXPRXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15,16-bisnor-13-oxo-8(17),11Elabdadien-19-oic acid (CHEBI:69973) has role metabolite (CHEBI:25212) |
| 15,16-bisnor-13-oxo-8(17),11Elabdadien-19-oic acid (CHEBI:69973) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1S,4aS,5S,8aR)-1,4a-dimethyl-6-methylidene-5-[(E)-3-oxobut-1-enyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid | ChEBI |
| Citations |
|---|