EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | [H][C@@]12CCC(=C)[C@H](C[C@H](O)[C@@](C)(O)C=C)[C@@]1(C)CCC[C@]2(C)C(=O)O |
| InChI | InChI=1S/C20H32O4/c1-6-20(5,24)16(21)12-14-13(2)8-9-15-18(14,3)10-7-11-19(15,4)17(22)23/h6,14-16,21,24H,1-2,7-12H2,3-5H3,(H,22,23)/t14-,15+,16-,18+,19-,20-/m0/s1 |
| InChIKey | GGPPLWSUIOWFBI-ZYLYKIMZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12S,13S-dihydroxylabda-8(17),14-dien-19-oic acid (CHEBI:69971) has role metabolite (CHEBI:25212) |
| 12S,13S-dihydroxylabda-8(17),14-dien-19-oic acid (CHEBI:69971) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|