EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O4 |
| Net Charge | 0 |
| Average Mass | 452.635 |
| Monoisotopic Mass | 452.29266 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](CCC(=C)C=C)[C@@]1(C)CCC[C@]2(C)COC(=O)/C=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C29H40O4/c1-6-21(2)8-14-25-28(4)18-7-17-27(3,24(28)16-19-29(25,5)32)20-33-26(31)15-11-22-9-12-23(30)13-10-22/h6,9-13,15,24-25,30,32H,1-2,7-8,14,16-20H2,3-5H3/b15-11-/t24-,25+,27+,28-,29+/m0/s1 |
| InChIKey | LXORINFASUBZBQ-DEYDKXAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8alpha-hydroxylabda-13(16),14-dien-19-yl-cis-4-hydroxycinnamate (CHEBI:69969) has role metabolite (CHEBI:25212) |
| 8alpha-hydroxylabda-13(16),14-dien-19-yl-cis-4-hydroxycinnamate (CHEBI:69969) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|