EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | [H][C@]1([C@H](O)c2ccc(O)c(OC)c2)OC[C@@H](O)[C@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C19H22O7/c1-24-15-7-10(3-5-12(15)20)17-14(22)9-26-19(17)18(23)11-4-6-13(21)16(8-11)25-2/h3-8,14,17-23H,9H2,1-2H3/t14-,17-,18-,19+/m1/s1 |
| InChIKey | VMDUTECRPCIIII-AXUOBQJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metasequirin E (CHEBI:69965) has role metabolite (CHEBI:25212) |
| Metasequirin E (CHEBI:69965) is a methoxybenzenes (CHEBI:51683) |
| Metasequirin E (CHEBI:69965) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| (1R)-2,5-Anhydro-3-deoxy-3-(4-hydroxy-3-methoxyphenyl)-1-C-(4-hydroxy-3-methoxyphenyl)-D-arabinitol | ChEBI |
| (3S,4R,5S)-5-[(R)-hydroxy-(4-hydroxy-3-methoxyphenyl)methyl]-4-(4-hydroxy-3-methoxyphenyl)oxolan-3-ol | ChEBI |
| Citations |
|---|