EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | C=C1C=C[C@@H](C(C)C)[C@]12CC=C(C(=O)O)CC2 |
| InChI | InChI=1S/C15H20O2/c1-10(2)13-5-4-11(3)15(13)8-6-12(7-9-15)14(16)17/h4-6,10,13H,3,7-9H2,1-2H3,(H,16,17)/t13-,15-/m0/s1 |
| InChIKey | NNQORNHPOYUTFB-ZFWWWQNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-rel-acora-2,4(14),8-trien-15-oic acid (CHEBI:69963) has role metabolite (CHEBI:25212) |
| (-)-rel-acora-2,4(14),8-trien-15-oic acid (CHEBI:69963) is a enol ether (CHEBI:47985) |
| (-)-rel-acora-2,4(14),8-trien-15-oic acid (CHEBI:69963) is a enone (CHEBI:51689) |
| Synonym | Source |
|---|---|
| rel-(1R,5S)-1-Isopropyl-4-methylenespiro[4.5]deca-2,7-diene-8-carboxylic acid | ChEBI |
| Citations |
|---|