EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC/C(C)=C/C(=O)O)[C@@]1(C)CC[C@@H](C)[C@@]2(C)O |
| InChI | InChI=1S/C20H32O3/c1-13(12-18(21)22)6-8-16-14(2)7-9-17-19(16,4)11-10-15(3)20(17,5)23/h12,15-17,23H,2,6-11H2,1,3-5H3,(H,21,22)/b13-12+/t15-,16+,17-,19-,20-/m1/s1 |
| InChIKey | KKSRPYFDSRXBHV-PIGWEYSDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metasequoic acid C, (rel)- (CHEBI:69961) has role metabolite (CHEBI:25212) |
| Metasequoic acid C, (rel)- (CHEBI:69961) is a carbocyclic fatty acid (CHEBI:35744) |
| Synonym | Source |
|---|---|
| rel-4alpha-hydroxy-methyl-18-(4->3alpha)-abeolabda-8(17),E-13-dien-15-oic acid | ChEBI |
| Citations |
|---|