EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H54O3 |
| Net Charge | 0 |
| Average Mass | 486.781 |
| Monoisotopic Mass | 486.40730 |
| SMILES | [H][C@@]12CC[C@@H](C(C)(C)O)[C@@]3(CCC(=O)O)C[C@]31CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC(CC)C(=C)C |
| InChI | InChI=1S/C32H54O3/c1-9-23(21(2)3)11-10-22(4)24-14-16-30(8)26-13-12-25(28(5,6)35)31(17-15-27(33)34)20-32(26,31)19-18-29(24,30)7/h22-26,35H,2,9-20H2,1,3-8H3,(H,33,34)/t22-,23?,24-,25+,26+,29-,30+,31-,32+/m1/s1 |
| InChIKey | XKNFVOLVUYNREE-JEWLOWAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metaseglyptorin A (CHEBI:69960) has role metabolite (CHEBI:25212) |
| Metaseglyptorin A (CHEBI:69960) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| 3,4-secocycloarta-4-hydroxy-24-ethyl-25-en-3-oic acid | ChEBI |
| Citations |
|---|