EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@@]12CC3=C(C)C(=O)O[C@@]3(O)C[C@@]1(C)CCCC2=C |
| InChI | InChI=1S/C15H20O3/c1-9-5-4-6-14(3)8-15(17)12(7-11(9)14)10(2)13(16)18-15/h11,17H,1,4-8H2,2-3H3/t11-,14+,15-/m0/s1 |
| InChIKey | FBMORZZOJSDNRQ-GLQYFDAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Atractylodes lancea (ncbitaxon:69406) | - | PubMed (21302967) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Atractylenolide III (CHEBI:69958) has role metabolite (CHEBI:25212) |
| Atractylenolide III (CHEBI:69958) is a naphthofuran (CHEBI:39270) |
| Synonym | Source |
|---|---|
| (4aS,8aR,9aS)-9a-hydroxy-3,8a-dimethyl-5-methylidene-4,4a,6,7,8,9-hexahydrobenzo[f][1]benzofuran-2-one | ChEBI |
| Citations |
|---|