EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CC/C(C)=C/CC[C@@H](C)/C=C/[C@@]1(C)CC[C@H]2C(C)(C)O |
| InChI | InChI=1S/C20H34O/c1-15-7-6-8-16(2)11-13-20(5)14-12-17(19(3,4)21)18(20)10-9-15/h7,11,13,16-18,21H,6,8-10,12,14H2,1-5H3/b13-11+,15-7+/t16-,17-,18+,20+/m1/s1 |
| InChIKey | DPKKEAURYKNYJG-CUDBNEOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane and methanol extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2E,4R,7E,11S,12R)-18-hydroxy-2,7-dolabelladiene (CHEBI:69956) has role metabolite (CHEBI:25212) |
| (1R,2E,4R,7E,11S,12R)-18-hydroxy-2,7-dolabelladiene (CHEBI:69956) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| 2-[(1R,3aR,4E,6R,12aS)-3a,6,10-Trimethyl-1,2,3,3a,6,7,8,11,12,12a-decahydrocyclopenta[11]annulen-1-yl]-2-propanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26393339 | ChemSpider |
| Citations |
|---|