EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@@]12CC/C(C)=C/CC[C@@H](C)/C=C/[C@@]1(C)CC[C@H]2C(=C)C |
| InChI | InChI=1S/C20H32/c1-15(2)18-12-14-20(5)13-11-17(4)8-6-7-16(3)9-10-19(18)20/h7,11,13,17-19H,1,6,8-10,12,14H2,2-5H3/b13-11+,16-7+/t17-,18+,19+,20+/m1/s1 |
| InChIKey | DQSHCYDPVQKJSC-IAGGUBJBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-(1R,2E,4R,7E,11S,12R)-2,7,18-Dolabellatriene (CHEBI:69955) has role metabolite (CHEBI:25212) |
| rel-(1R,2E,4R,7E,11S,12R)-2,7,18-Dolabellatriene (CHEBI:69955) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|