EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)CC[C@@H]2C(C)(C)O |
| InChI | InChI=1S/C20H34O/c1-15-7-6-8-16(2)11-13-20(5)14-12-17(19(3,4)21)18(20)10-9-15/h7,11,17-18,21H,6,8-10,12-14H2,1-5H3/b15-7+,16-11+/t17-,18-,20-/m0/s1 |
| InChIKey | OEBBSSBZPLXOHC-JZTGRNQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-((1S,3aR,5E,9E,12aS)-3a,6,10-trimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulen-1-yl)propan-2-ol (CHEBI:69953) has role metabolite (CHEBI:25212) |
| 2-((1S,3aR,5E,9E,12aS)-3a,6,10-trimethyl-1,2,3,3a,4,7,8,11,12,12a-decahydrocyclopenta[11]annulen-1-yl)propan-2-ol (CHEBI:69953) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|