EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CC[C@]3(C)O[C@@]3([H])CC/C(C)=C/C[C@@]1(C)C(=O)C[C@@H]2C(=C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)15-12-17(21)19(4)10-8-14(3)6-7-18-20(5,22-18)11-9-16(15)19/h8,15-16,18H,1,6-7,9-12H2,2-5H3/b14-8+/t15-,16+,18+,19-,20+/m1/s1 |
| InChIKey | BGCBFCPMURPDPJ-DKMZEYLLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,3E,7S,8S,11S,12S)-7,8-Epoxy-14-oxo-3,18-dolabelladiene (CHEBI:69950) has role metabolite (CHEBI:25212) |
| (1R,3E,7S,8S,11S,12S)-7,8-Epoxy-14-oxo-3,18-dolabelladiene (CHEBI:69950) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|