EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O3 |
| Net Charge | 0 |
| Average Mass | 346.511 |
| Monoisotopic Mass | 346.25079 |
| SMILES | [H][C@@]12CC/C(C)=C/CC[C@]3(C)O[C@@]3([H])C[C@@]1(C)[C@@H](OC(C)=O)C[C@@H]2C(=C)C |
| InChI | InChI=1S/C22H34O3/c1-14(2)17-12-19(24-16(4)23)21(5)13-20-22(6,25-20)11-7-8-15(3)9-10-18(17)21/h8,17-20H,1,7,9-13H2,2-6H3/b15-8+/t17-,18+,19+,20+,21-,22+/m1/s1 |
| InChIKey | UVAWBGLQQAGQHW-SKMPXITJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane and methanol extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,3S,4S,7E,11S,12S,14S)-14-Acetoxy-3,4-epoxy-7,18-dolabelladiene (CHEBI:69949) has role metabolite (CHEBI:25212) |
| (1R,3S,4S,7E,11S,12S,14S)-14-Acetoxy-3,4-epoxy-7,18-dolabelladiene (CHEBI:69949) is a carboxylic ester (CHEBI:33308) |
| Citations |
|---|