EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | [H][C@@]12CC/C(C)=C/CC[C@]3(C)O[C@@]3([H])C[C@@]1(C)CC[C@@H]2C(=C)C |
| InChI | InChI=1S/C20H32O/c1-14(2)16-10-12-19(4)13-18-20(5,21-18)11-6-7-15(3)8-9-17(16)19/h7,16-18H,1,6,8-13H2,2-5H3/b15-7+/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | DAWVJYSOOMMDRV-RKSCGOAZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dolabellane analog-8 (CHEBI:69948) has role metabolite (CHEBI:25212) |
| Dolabellane analog-8 (CHEBI:69948) is a epoxide (CHEBI:32955) |
| Synonym | Source |
|---|---|
| 3,4-epoxy-7,18-dolabelladiene | ChEBI |
| Citations |
|---|