EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CC/C(C)=C/CC[C@]3(C)O[C@@]3([H])C[C@@]1(C)C(=O)C[C@@H]2C(=C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)15-11-17(21)19(4)12-18-20(5,22-18)10-6-7-14(3)8-9-16(15)19/h7,15-16,18H,1,6,8-12H2,2-5H3/b14-7+/t15-,16+,18+,19-,20+/m1/s1 |
| InChIKey | GUSAEAVUMKCIQK-KCAVMMMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dolabellane analog-7 (CHEBI:69947) has role metabolite (CHEBI:25212) |
| Dolabellane analog-7 (CHEBI:69947) is a ketone (CHEBI:17087) |
| Synonym | Source |
|---|---|
| (1aS,7aS,8S,10aR,11aS)-8-Isopropenyl-1a,5,10a-trimethyl-2,3,6,7,7a,8,9,10a,11,11a-decahydrocyclopenta[4,5]cycloundeca[1,2-b]oxiren-10(1aH)-one | ChEBI |
| Citations |
|---|