EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O2 |
| Net Charge | 0 |
| Average Mass | 330.512 |
| Monoisotopic Mass | 330.25588 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)[C@@H](OC(C)=O)C[C@@H]2C(=C)C |
| InChI | InChI=1S/C22H34O2/c1-15(2)19-14-21(24-18(5)23)22(6)13-12-17(4)9-7-8-16(3)10-11-20(19)22/h8,12,19-21H,1,7,9-11,13-14H2,2-6H3/b16-8+,17-12+/t19-,20+,21+,22-/m1/s1 |
| InChIKey | AJUISUYGDAPGKA-KMXMIPMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dilophus spiralis (ncbitaxon:499621) | - | PubMed (21190330) | Dichloromethane extract of freeze-dried alga |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,3E,7E,11S,12S,14S)-14-Acetoxy-3,7,18-dolabellatriene (CHEBI:69946) has role metabolite (CHEBI:25212) |
| (1R,3E,7E,11S,12S,14S)-14-Acetoxy-3,7,18-dolabellatriene (CHEBI:69946) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|