EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O4 |
| Net Charge | 0 |
| Average Mass | 326.392 |
| Monoisotopic Mass | 326.15181 |
| SMILES | C=CC(C)(C)c1c2c(c(OC)c3ccc(=O)oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C20H22O4/c1-7-19(2,3)15-17-12(8-9-14(21)23-17)16(22-6)13-10-11-20(4,5)24-18(13)15/h7-11H,1H2,2-6H3 |
| InChIKey | QBFYQVZGIDUNIY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clausena harmandiana (ncbitaxon:159036) | root (BTO:0001188) | PubMed (21302964) | Crude ethyl acetate extract of air-dried, powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dentatin (CHEBI:69939) has role metabolite (CHEBI:25212) |
| Dentatin (CHEBI:69939) is a coumarins (CHEBI:23403) |
| Synonyms | Source |
|---|---|
| 10-(1,1-Dimethyl-allyl)-5-methoxy-8,8-dimethyl-8H-pyrano(3,2-g)chromen-2-one | ChEBI |
| Poncitrin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:22980-57-0 | ChemIDplus |
| Citations |
|---|