EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11NO3 |
| Net Charge | 0 |
| Average Mass | 241.246 |
| Monoisotopic Mass | 241.07389 |
| SMILES | COc1ccc2nc3cc(O)c(C=O)cc3c2c1 |
| InChI | InChI=1S/C14H11NO3/c1-18-9-2-3-12-11(5-9)10-4-8(7-16)14(17)6-13(10)15-12/h2-7,15,17H,1H3 |
| InChIKey | INFFNJXOAJWVCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clausena harmandiana (ncbitaxon:159036) | root (BTO:0001188) | PubMed (21302964) | Crude ethyl acetate extract of air-dried, powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lansine (CHEBI:69937) has role metabolite (CHEBI:25212) |
| Lansine (CHEBI:69937) is a carbazoles (CHEBI:48513) |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-6-methoxy-9H-carbazole-3-carbaldehyde | ChEBI |
| Clausine I | ChEBI |
| Citations |
|---|