EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H35ClNO3S.Na |
| Net Charge | 0 |
| Average Mass | 608.179 |
| Monoisotopic Mass | 607.19239 |
| SMILES | CC(C)(O)c1ccccc1CC[C@@H](SCC1(CC(=O)[O-])CC1)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1.[Na+] |
| InChI | InChI=1S/C35H36ClNO3S.Na/c1-34(2,40)30-9-4-3-7-25(30)13-17-32(41-23-35(18-19-35)22-33(38)39)27-8-5-6-24(20-27)10-15-29-16-12-26-11-14-28(36)21-31(26)37-29;/h3-12,14-16,20-21,32,40H,13,17-19,22-23H2,1-2H3,(H,38,39);/q;+1/p-1/b15-10+;/t32-;/m1./s1 |
| InChIKey | LBFBRXGCXUHRJY-HKHDRNBDSA-M |
| Roles Classification |
|---|
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| montelukast sodium (CHEBI:6993) has part montelukast(1−) (CHEBI:49165) |
| montelukast sodium (CHEBI:6993) has role anti-allergic agent (CHEBI:50857) |
| montelukast sodium (CHEBI:6993) has role anti-asthmatic agent (CHEBI:65023) |
| montelukast sodium (CHEBI:6993) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium {1-[({(1R)-1-{3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl}-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl}sulfanyl)methyl]cyclopropyl}acetate |
| Synonyms | Source |
|---|---|
| 1-((((1R)-1-(3-((1E)-2-(7-chloro-2-quinolinyl)ethenyl)phenyl)-3-(2-(1-hydroxy-1-methylethyl)phenyl)propyl)thio)methyl)cyclopropaneacetic acid monosodium salt | ChemIDplus |
| MK-476 | ChEMBL |
| Montelukast (as sodium) | ChEMBL |
| Montelukast monosodium salt | ChEMBL |
| Montelukast sodium | KEGG COMPOUND |
| Montelukast sodium salt | Patent |
| Brand Names | Source |
|---|---|
| Montair | DrugBank |
| Singulair | ChemIDplus |
| Singular | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7612011 | Beilstein |
| CAS:151767-02-1 | KEGG COMPOUND |
| CAS:151767-02-1 | ChemIDplus |
| Citations |
|---|