EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O4 |
| Net Charge | 0 |
| Average Mass | 258.273 |
| Monoisotopic Mass | 258.08921 |
| SMILES | COc1c2c(cc3oc(=O)ccc13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C15H14O4/c1-15(2)7-6-10-12(19-15)8-11-9(14(10)17-3)4-5-13(16)18-11/h4-8H,1-3H3 |
| InChIKey | JSJIIHRNDMLJGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clausena harmandiana (ncbitaxon:159036) | root (BTO:0001188) | PubMed (21302964) | Crude ethyl acetate extract of air-dried, powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xanthoxyletin (CHEBI:69929) has role metabolite (CHEBI:25212) |
| Xanthoxyletin (CHEBI:69929) is a coumarins (CHEBI:23403) |
| Synonyms | Source |
|---|---|
| 5-methoxy-2,2-dimethylpyrano[3,2-g]chromen-8-one | ChEBI |
| 7-Hydroxy-5-methoxy-2,2-dimethyl-2H-1-benzopyran-6-acrylic Acid delta-Lactone | ChEBI |
| Xanthoxylin N | ChEBI |
| Xanthoxyloin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033931 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:84-99-1 | ChemIDplus |
| Citations |
|---|