EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO3 |
| Net Charge | 0 |
| Average Mass | 309.365 |
| Monoisotopic Mass | 309.13649 |
| SMILES | COc1ccc2c(c1)nc1c(CC=C(C)C)c(O)c(C=O)cc12 |
| InChI | InChI=1S/C19H19NO3/c1-11(2)4-6-15-18-16(8-12(10-21)19(15)22)14-7-5-13(23-3)9-17(14)20-18/h4-5,7-10,20,22H,6H2,1-3H3 |
| InChIKey | RJWKVZMWLOWCMX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clausena harmandiana (ncbitaxon:159036) | root (BTO:0001188) | PubMed (21302964) | Crude ethyl acetate extract of air-dried, powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Methoxyheptaphylline (CHEBI:69928) has role metabolite (CHEBI:25212) |
| 7-Methoxyheptaphylline (CHEBI:69928) is a carbazoles (CHEBI:48513) |
| Synonym | Source |
|---|---|
| 2-Hydroxy-7-methoxy-1-(3-methyl-2-buten-1-yl)-9H-carbazole-3-carbaldehyde | ChEBI |
| Citations |
|---|