EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28N4O5 |
| Net Charge | 0 |
| Average Mass | 380.445 |
| Monoisotopic Mass | 380.20597 |
| SMILES | Cc1nc(=O)c(C(C)C)nc1C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C18H28N4O5/c1-8(2)7-12(15(23)20-11(6)18(26)27)21-17(25)14-10(5)19-16(24)13(22-14)9(3)4/h8-9,11-12H,7H2,1-6H3,(H,19,24)(H,20,23)(H,21,25)(H,26,27)/t11-,12+/m0/s1 |
| InChIKey | UWRBCOGQVDTYGV-NWDGAFQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (21728289) | Strain isolated from marine sponge Strain: SpD081030SC 03 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-57 (CHEBI:69921) has role metabolite (CHEBI:25212) |
| JBIR-57 (CHEBI:69921) is a peptide (CHEBI:16670) |
| Synonym | Source |
|---|---|
| N-[(6-Isopropyl-3-methyl-5-oxo-4,5-dihydro-2-pyrazinyl)carbonyl]-D-leucyl-L-alanine | ChEBI |
| Citations |
|---|