EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO6 |
| Net Charge | 0 |
| Average Mass | 383.400 |
| Monoisotopic Mass | 383.13689 |
| SMILES | [H][C@]1([C@@]2([H])c3cc4c(cc3CCN2C)OCO4)OC(=O)c2c1ccc(OC)c2OC |
| InChI | InChI=1S/C21H21NO6/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | JZUTXVTYJDCMDU-MOPGFXCFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hydrastis canadensis (ncbitaxon:13569) | leaf (BTO:0000713) | PubMed (21661731) | EtOH:H2O(50:50) extract of leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydrastine (CHEBI:69919) has role metabolite (CHEBI:25212) |
| Hydrastine (CHEBI:69919) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| (3S)-6,7-dimethoxy-3-[(5R)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3H-2-benzofuran-1-one | ChEBI |
| Hydrastine | ChEMBL |
| NSC-757430 | ChEMBL |
| Citations |
|---|