EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O5 |
| Net Charge | 0 |
| Average Mass | 298.294 |
| Monoisotopic Mass | 298.08412 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1C |
| InChI | InChI=1S/C17H14O5/c1-9-14(21-2)7-12(19)16-13(20)8-15(22-17(9)16)10-3-5-11(18)6-4-10/h3-8,18-19H,1-2H3 |
| InChIKey | IFIBDPUYMKDGNN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dracaena cochinchinensis (ncbitaxon:593754) | - | PubMed (21661731) | |
| Hydrastis canadensis (ncbitaxon:13569) | leaf (BTO:0000713) | PubMed (21661731) | EtOH:H2O(50:50) extract of leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-desmethylsideroxylin (CHEBI:69918) has functional parent sideroxylin (CHEBI:69916) |
| 6-desmethylsideroxylin (CHEBI:69918) has role plant metabolite (CHEBI:76924) |
| 6-desmethylsideroxylin (CHEBI:69918) is a dihydroxyflavone (CHEBI:38686) |
| 6-desmethylsideroxylin (CHEBI:69918) is a monomethoxyflavone (CHEBI:25401) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-8-methyl-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21741791 | Reaxys |
| Citations |
|---|