EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48O12 |
| Net Charge | 0 |
| Average Mass | 684.779 |
| Monoisotopic Mass | 684.31458 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)C(=C)[C@H](OC(C)=O)[C@@H](OC(=O)c3ccccc3)[C@@H](OC(C)=O)C(C)(C)/C=C/[C@@H](C)C(=O)[C@@]1(O)C[C@H](C)[C@@H]2OC(=O)C(C)C |
| InChI | InChI=1S/C37H48O12/c1-19(2)34(42)48-28-21(4)18-37(44)27(28)29(45-23(6)38)22(5)30(46-24(7)39)31(49-35(43)26-14-12-11-13-15-26)33(47-25(8)40)36(9,10)17-16-20(3)32(37)41/h11-17,19-21,27-31,33,44H,5,18H2,1-4,6-10H3/b17-16+/t20-,21+,27-,28+,29+,30+,31-,33-,37-/m1/s1 |
| InChIKey | ZDNXSCUQPPKQFI-HNNPOHMXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia dendroides (ncbitaxon:38845) | aerial part (BTO:0001658) | PubMed (21707046) | 60% aqueous ethanol extract of Dried plant material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphodendrophane D, (rel)- (CHEBI:69912) has role metabolite (CHEBI:25212) |
| Euphodendrophane D, (rel)- (CHEBI:69912) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|