EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H49NO12 |
| Net Charge | 0 |
| Average Mass | 699.794 |
| Monoisotopic Mass | 699.32548 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)C(=C)[C@H](OC(=O)C(C)C)[C@@H](OC(C)=O)[C@@H](OC(=O)c3cccnc3)C(C)(C)/C=C/[C@@H](C)C(=O)[C@@]1(O)C[C@H](C)[C@@H]2OC(=O)CC |
| InChI | InChI=1S/C37H49NO12/c1-11-26(41)48-28-21(5)17-37(45)27(28)29(46-23(7)39)22(6)30(49-34(43)19(2)3)31(47-24(8)40)33(36(9,10)15-14-20(4)32(37)42)50-35(44)25-13-12-16-38-18-25/h12-16,18-21,27-31,33,45H,6,11,17H2,1-5,7-10H3/b15-14+/t20-,21+,27-,28+,29+,30+,31-,33-,37-/m1/s1 |
| InChIKey | AUEQFHWGTNJTOG-CEWNMCSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia dendroides (ncbitaxon:38845) | aerial part (BTO:0001658) | PubMed (21707046) | 60% aqueous ethanol extract of Dried plant material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Euphodendrophane A, (rel)- (CHEBI:69909) has role metabolite (CHEBI:25212) |
| Euphodendrophane A, (rel)- (CHEBI:69909) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|