EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O3 |
| Net Charge | 0 |
| Average Mass | 184.235 |
| Monoisotopic Mass | 184.10994 |
| SMILES | C[C@@H](O)CCC/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C10H16O3/c1-9(11)7-5-3-2-4-6-8-10(12)13/h2,4,6,8-9,11H,3,5,7H2,1H3,(H,12,13)/b4-2+,8-6+/t9-/m1/s1 |
| InChIKey | BUNUAXLBBKVLBE-WMCYJUNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (21699149) | Ethyl acetate extract of Bacilli Strain: 09ID194 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ieodomycin D (CHEBI:69908) has role metabolite (CHEBI:25212) |
| Ieodomycin D (CHEBI:69908) is a hydroxy fatty acid (CHEBI:24654) |
| Synonym | Source |
|---|---|
| (2E,4E,9R)-9-hydroxydeca-2,4-dienoic acid | ChEBI |
| Citations |
|---|