EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | 0 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13616 |
| SMILES | C[C@@H](O)CCC/C=C/C=C/[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C12H20O4/c1-10(13)7-5-3-2-4-6-8-11(14)9-12(15)16/h2,4,6,8,10-11,13-14H,3,5,7,9H2,1H3,(H,15,16)/b4-2+,8-6+/t10-,11-/m1/s1 |
| InChIKey | LWHVEMXRYKVHKX-HKSGNEMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (21699149) | Ethyl acetate extract of Bacilli Strain: 09ID194 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ieodomycin C (CHEBI:69907) has role metabolite (CHEBI:25212) |
| Ieodomycin C (CHEBI:69907) is a carbonyl compound (CHEBI:36586) |
| Synonym | Source |
|---|---|
| (3S,4E,6E,11R)-3,11-dihydroxydodeca-4,6-dienoic acid | ChEBI |
| Citations |
|---|