EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18O3 |
| Net Charge | 0 |
| Average Mass | 210.273 |
| Monoisotopic Mass | 210.12559 |
| SMILES | C=C/C=C(\C)CC[C@@H]1C[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C12H18O3/c1-3-4-9(2)5-6-11-7-10(13)8-12(14)15-11/h3-4,10-11,13H,1,5-8H2,2H3/b9-4+/t10-,11+/m0/s1 |
| InChIKey | UFMCBVUOEQAWAI-LTJOXERKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (21699149) | Ethyl acetate extract of Bacilli Strain: 09ID194 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ieodomycin B (CHEBI:69906) has role metabolite (CHEBI:25212) |
| Ieodomycin B (CHEBI:69906) is a δ-lactone (CHEBI:18946) |
| Synonym | Source |
|---|---|
| (4S,6R)-4-hydroxy-6-((E)-3-methylhexa-3,5-dienyl)tetrahydro-2H-pyran-2-one | ChEBI |
| Citations |
|---|