EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O4 |
| Net Charge | 0 |
| Average Mass | 242.315 |
| Monoisotopic Mass | 242.15181 |
| SMILES | C=C/C=C(\C)CC[C@@H](O)C[C@H](O)CC(=O)OC |
| InChI | InChI=1S/C13H22O4/c1-4-5-10(2)6-7-11(14)8-12(15)9-13(16)17-3/h4-5,11-12,14-15H,1,6-9H2,2-3H3/b10-5+/t11-,12+/m1/s1 |
| InChIKey | LMFWMDRALYGQES-SRXIBPRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (21699149) | Ethyl acetate extract of Bacilli Strain: 09ID194 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ieodomycin A (CHEBI:69905) has role metabolite (CHEBI:25212) |
| Ieodomycin A (CHEBI:69905) is a aliphatic alcohol (CHEBI:2571) |
| Synonym | Source |
|---|---|
| (3S,5R,8E)-methyl 3,5-dihydroxy-8-methylundeca-8,10-dienoate | ChEBI |
| Citations |
|---|