EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48O9 |
| Net Charge | 0 |
| Average Mass | 576.727 |
| Monoisotopic Mass | 576.32983 |
| SMILES | C/C=C(\C)C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(C)/C=C(C)/C=C/CC(C)/C=C/c1oc(OC)c(CC)c(=O)c1C |
| InChI | InChI=1S/C32H48O9/c1-9-20(5)30(41-32-29(37)28(36)27(35)25(17-33)40-32)21(6)16-19(4)13-11-12-18(3)14-15-24-22(7)26(34)23(10-2)31(38-8)39-24/h9,11,13-16,18,21,25,27-30,32-33,35-37H,10,12,17H2,1-8H3/b13-11+,15-14+,19-16+,20-9+/t18?,21?,25-,27-,28+,29-,30?,32+/m1/s1 |
| InChIKey | FHZSIAFPPYOOGE-NUECQFBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | mycelium (BTO:0001436) | PubMed (21718029) | Ethyl acetate extract of mycelial cake Strain: POR 04 15 053 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PM060431 (CHEBI:69900) has role metabolite (CHEBI:25212) |
| PM060431 (CHEBI:69900) is a terpene glycoside (CHEBI:61777) |
| Synonym | Source |
|---|---|
| (2E,6E,8E,12E)-13-(5-Ethyl-6-methoxy-3-methyl-4-oxo-4H-pyran-2-yl)-3,5,7,11-tetramethyl-2,6,8,12-tridecatetraen-4-yl beta-D-glucopyranoside | ChEBI |
| Citations |
|---|